C20H21FIN5O — CID 52951107
N-[[4-(diethylaminomethyl)-2-fluoro-3-pyridinyl]methyl]-6-(125I)iodoquinoxaline-2-carboxamide (PubChem CID 52951107) has the molecular formula C20H21FIN5O and a molecular weight of 491.32 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)-2-fluoro-3-pyridinyl]methyl]-6-(125I)iodoquinoxaline-2-carboxamide.
| Compound Name | N-[[4-(diethylaminomethyl)-2-fluoro-3-pyridinyl]methyl]-6-(125I)iodoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 52951107 |
| Molecular Formula | C20H21FIN5O |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[[4-(diethylaminomethyl)-2-fluoro-3-pyridinyl]methyl]-6-(125I)iodoquinoxaline-2-carboxamide |
| SMILES | CCN(CC)Cc1ccnc(F)c1CNC(=O)c1cnc2cc([125I])ccc2n1 |
| InChI | InChI=1S/C20H21FIN5O/c1-3-27(4-2)12-13-7-8-23-19(21)15(13)10-25-20(28)18-11-24-17-9-14(22)5-6-16(17)26-18/h5-9,11H,3-4,10,12H2,1-2H3,(H,25,28)/i22-2 |
| InChIKey | VEXUIEPYCAQLMB-ONBQKKEBSA-N |
| XLogP | 3.54 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|