C15H21Cl2IN4O — CID 90664604
N-[2-(diethylamino)ethyl]-6-(131I)iodoquinoxaline-2-carboxamide;dihydrochloride (PubChem CID 90664604) has the molecular formula C15H21Cl2IN4O and a molecular weight of 475.17 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-(131I)iodoquinoxaline-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-6-(131I)iodoquinoxaline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 90664604 |
| Molecular Formula | C15H21Cl2IN4O |
| Molecular Weight | 475.17 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-(131I)iodoquinoxaline-2-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cnc2cc([131I])ccc2n1.Cl.Cl |
| InChI | InChI=1S/C15H19IN4O.2ClH/c1-3-20(4-2)8-7-17-15(21)14-10-18-13-9-11(16)5-6-12(13)19-14;;/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,21);2*1H/i16+4;; |
| InChIKey | XEODMHQABAPGED-ASHBWYNSSA-N |
| XLogP | 3.15 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|