C19H29N3O — CID 143617083
N-[2-(diethylamino)ethyl]-5-methylisoquinoline-3-carboxamide;ethane (PubChem CID 143617083) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-methylisoquinoline-3-carboxamide;ethane.
| Compound Name | N-[2-(diethylamino)ethyl]-5-methylisoquinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143617083 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-methylisoquinoline-3-carboxamide;ethane |
| SMILES | CC.CCN(CC)CCNC(=O)c1cc2c(C)cccc2cn1 |
| InChI | InChI=1S/C17H23N3O.C2H6/c1-4-20(5-2)10-9-18-17(21)16-11-15-13(3)7-6-8-14(15)12-19-16;1-2/h6-8,11-12H,4-5,9-10H2,1-3H3,(H,18,21);1-2H3 |
| InChIKey | HRFUJPYXABYQDG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |