C16H21IN4O — CID 158106861
N-[2-[ethyl(propyl)amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide (PubChem CID 158106861) has the molecular formula C16H21IN4O and a molecular weight of 410.28 g/mol. Its IUPAC name is N-[2-[ethyl(propyl)amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide.
| Compound Name | N-[2-[ethyl(propyl)amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 158106861 |
| Molecular Formula | C16H21IN4O |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[2-[ethyl(propyl)amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide |
| SMILES | CCCN(CC)CCNC(=O)c1cnc2cc([125I])ccc2n1 |
| InChI | InChI=1S/C16H21IN4O/c1-3-8-21(4-2)9-7-18-16(22)15-11-19-14-10-12(17)5-6-13(14)20-15/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,18,22)/i17-2 |
| InChIKey | UVAGAGYWWUQMKZ-QZIRHQCUSA-N |
| XLogP | 2.70 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|