C11H18F2N4O — CID 19264128
N-[2-(diethylamino)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 19264128) has the molecular formula C11H18F2N4O and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264128 |
| Molecular Formula | C11H18F2N4O |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C11H18F2N4O/c1-3-16(4-2)8-6-14-10(18)9-5-7-17(15-9)11(12)13/h5,7,11H,3-4,6,8H2,1-2H3,(H,14,18) |
| InChIKey | OABNQVVBGFPQFM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |