C36H50FN5O2Sn — CID 52952477
N-[2-[ethyl-[2-[(2-fluoro-3-pyridinyl)oxy]ethyl]amino]ethyl]-7-tributylstannylphenazine-1-carboxamide (PubChem CID 52952477) has the molecular formula C36H50FN5O2Sn and a molecular weight of 722.54 g/mol. Its IUPAC name is N-[2-[ethyl-[2-[(2-fluoro-3-pyridinyl)oxy]ethyl]amino]ethyl]-7-tributylstannylphenazine-1-carboxamide.
| Compound Name | N-[2-[ethyl-[2-[(2-fluoro-3-pyridinyl)oxy]ethyl]amino]ethyl]-7-tributylstannylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 52952477 |
| Molecular Formula | C36H50FN5O2Sn |
| Molecular Weight | 722.54 g/mol |
| Exact Mass | 723.30 |
| IUPAC Name | N-[2-[ethyl-[2-[(2-fluoro-3-pyridinyl)oxy]ethyl]amino]ethyl]-7-tributylstannylphenazine-1-carboxamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2nc3c(C(=O)NCCN(CC)CCOc4cccnc4F)cccc3nc2c1 |
| InChI | InChI=1S/C24H23FN5O2.3C4H9.Sn/c1-2-30(15-16-32-21-11-6-12-26-23(21)25)14-13-27-24(31)17-7-5-10-20-22(17)29-19-9-4-3-8-18(19)28-20;3*1-3-4-2;/h4-12H,2,13-16H2,1H3,(H,27,31);3*1,3-4H2,2H3; |
| InChIKey | GWEFADUOQDXSTI-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.54 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|