C32H49N3OSn — CID 59228761
N-[2-(diethylamino)ethyl]-5-tributylstannylacridine-4-carboxamide (PubChem CID 59228761) has the molecular formula C32H49N3OSn and a molecular weight of 610.48 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-tributylstannylacridine-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-tributylstannylacridine-4-carboxamide |
|---|---|
| PubChem CID | 59228761 |
| Molecular Formula | C32H49N3OSn |
| Molecular Weight | 610.48 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-tributylstannylacridine-4-carboxamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc2cc3cccc(C(=O)NCCN(CC)CC)c3nc12 |
| InChI | InChI=1S/C20H22N3O.3C4H9.Sn/c1-3-23(4-2)13-12-21-20(24)17-10-7-9-16-14-15-8-5-6-11-18(15)22-19(16)17;3*1-3-4-2;/h5-10,14H,3-4,12-13H2,1-2H3,(H,21,24);3*1,3-4H2,2H3; |
| InChIKey | IAKGWAQMLKPFTF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.48 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|