C22H37N3O2 — CID 143617094
N-[2-(diethylamino)ethyl]-6-ethyl-4-oxo-1H-quinoline-3-carboxamide;ethane (PubChem CID 143617094) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-ethyl-4-oxo-1H-quinoline-3-carboxamide;ethane.
| Compound Name | N-[2-(diethylamino)ethyl]-6-ethyl-4-oxo-1H-quinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143617094 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-ethyl-4-oxo-1H-quinoline-3-carboxamide;ethane |
| SMILES | CC.CC.CCc1ccc2[nH]cc(C(=O)NCCN(CC)CC)c(=O)c2c1 |
| InChI | InChI=1S/C18H25N3O2.2C2H6/c1-4-13-7-8-16-14(11-13)17(22)15(12-20-16)18(23)19-9-10-21(5-2)6-3;2*1-2/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,23)(H,20,22);2*1-2H3 |
| InChIKey | YSYRENVMYKIIEZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |