C15H16FNO3 — CID 25235216
3-(18F)fluoropropyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 25235216) has the molecular formula C15H16FNO3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-(18F)fluoropropyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | 3-(18F)fluoropropyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 25235216 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-(18F)fluoropropyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCc1ccc2[nH]cc(C(=O)OCCC[18F])c(=O)c2c1 |
| InChI | InChI=1S/C15H16FNO3/c1-2-10-4-5-13-11(8-10)14(18)12(9-17-13)15(19)20-7-3-6-16/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,18)/i16-1 |
| InChIKey | PSRVUCHUXREXRV-GKTGUEEDSA-N |
| XLogP | 2.61 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|