C15H17FN2O2 — CID 25235263
6-(2-(18F)fluoroethyl)-4-oxo-N-propyl-1H-quinoline-3-carboxamide (PubChem CID 25235263) has the molecular formula C15H17FN2O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-(2-(18F)fluoroethyl)-4-oxo-N-propyl-1H-quinoline-3-carboxamide.
| Compound Name | 6-(2-(18F)fluoroethyl)-4-oxo-N-propyl-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 25235263 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-(2-(18F)fluoroethyl)-4-oxo-N-propyl-1H-quinoline-3-carboxamide |
| SMILES | CCCNC(=O)c1c[nH]c2ccc(CC[18F])cc2c1=O |
| InChI | InChI=1S/C15H17FN2O2/c1-2-7-17-15(20)12-9-18-13-4-3-10(5-6-16)8-11(13)14(12)19/h3-4,8-9H,2,5-7H2,1H3,(H,17,20)(H,18,19)/i16-1 |
| InChIKey | VWNXVGATGFPWHO-GKTGUEEDSA-N |
| XLogP | 2.18 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |