C20H17FN2O4 — CID 118578514
methyl 2-[[6-[(2-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carbonyl]amino]acetate (PubChem CID 118578514) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is methyl 2-[[6-[(2-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[6-[(2-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 118578514 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl 2-[[6-[(2-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1c[nH]c2ccc(Cc3ccccc3F)cc2c1=O |
| InChI | InChI=1S/C20H17FN2O4/c1-27-18(24)11-23-20(26)15-10-22-17-7-6-12(9-14(17)19(15)25)8-13-4-2-3-5-16(13)21/h2-7,9-10H,8,11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | ROKGFRCADFNABG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |