C19H17FN2O2 — CID 25210565
6-benzyl-N-(2-(18F)fluoroethyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 25210565) has the molecular formula C19H17FN2O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 6-benzyl-N-(2-(18F)fluoroethyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-benzyl-N-(2-(18F)fluoroethyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 25210565 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 6-benzyl-N-(2-(18F)fluoroethyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCC[18F])c1c[nH]c2ccc(Cc3ccccc3)cc2c1=O |
| InChI | InChI=1S/C19H17FN2O2/c20-8-9-21-19(24)16-12-22-17-7-6-14(11-15(17)18(16)23)10-13-4-2-1-3-5-13/h1-7,11-12H,8-10H2,(H,21,24)(H,22,23)/i20-1 |
| InChIKey | FQCVKMJBEWJMHR-LRFGSCOBSA-N |
| XLogP | 2.82 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |