C19H15ClFNO3 — CID 171485774
ethyl 6-[(2-chloro-4-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 171485774) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is ethyl 6-[(2-chloro-4-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-[(2-chloro-4-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 171485774 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | ethyl 6-[(2-chloro-4-fluorophenyl)methyl]-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ccc(Cc3ccc(F)cc3Cl)cc2c1=O |
| InChI | InChI=1S/C19H15ClFNO3/c1-2-25-19(24)15-10-22-17-6-3-11(8-14(17)18(15)23)7-12-4-5-13(21)9-16(12)20/h3-6,8-10H,2,7H2,1H3,(H,22,23) |
| InChIKey | SNIRYVRLQNFGJV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |