C13H11F3N2O3 — CID 162518104
ethyl 4-oxo-6-(trifluoromethylamino)-1H-quinoline-3-carboxylate (PubChem CID 162518104) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is ethyl 4-oxo-6-(trifluoromethylamino)-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 4-oxo-6-(trifluoromethylamino)-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 162518104 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | ethyl 4-oxo-6-(trifluoromethylamino)-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ccc(NC(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C13H11F3N2O3/c1-2-21-12(20)9-6-17-10-4-3-7(18-13(14,15)16)5-8(10)11(9)19/h3-6,18H,2H2,1H3,(H,17,19) |
| InChIKey | LVEXJXFPCWVWKD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|