C28H21N3O4 — CID 39850128
ethyl 4-oxo-6-[(2-phenylquinoline-4-carbonyl)amino]-1H-quinoline-3-carboxylate (PubChem CID 39850128) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is ethyl 4-oxo-6-[(2-phenylquinoline-4-carbonyl)amino]-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 4-oxo-6-[(2-phenylquinoline-4-carbonyl)amino]-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 39850128 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | ethyl 4-oxo-6-[(2-phenylquinoline-4-carbonyl)amino]-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ccc(NC(=O)c3cc(-c4ccccc4)nc4ccccc34)cc2c1=O |
| InChI | InChI=1S/C28H21N3O4/c1-2-35-28(34)22-16-29-23-13-12-18(14-21(23)26(22)32)30-27(33)20-15-25(17-8-4-3-5-9-17)31-24-11-7-6-10-19(20)24/h3-16H,2H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | AFQSQECROINDNU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |