C14H14N2O6S — CID 134098178
ethyl 6-(acetylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 134098178) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is ethyl 6-(acetylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-(acetylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 134098178 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | ethyl 6-(acetylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ccc(S(=O)(=O)NC(C)=O)cc2c1=O |
| InChI | InChI=1S/C14H14N2O6S/c1-3-22-14(19)11-7-15-12-5-4-9(6-10(12)13(11)18)23(20,21)16-8(2)17/h4-7H,3H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | QWOUAALKLVESMK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |