C13H13NO5S — CID 142164950
ethyl 6-methylsulfonyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 142164950) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl 6-methylsulfonyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-methylsulfonyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142164950 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | ethyl 6-methylsulfonyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ccc(S(C)(=O)=O)cc2c1=O |
| InChI | InChI=1S/C13H13NO5S/c1-3-19-13(16)10-7-14-11-5-4-8(20(2,17)18)6-9(11)12(10)15/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | BWDALHPNRMVKDH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |