C21H25N2O5P — CID 59835576
N-(2-diethoxyphosphorylethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide (PubChem CID 59835576) has the molecular formula C21H25N2O5P and a molecular weight of 416.41 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-(2-diethoxyphosphorylethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 59835576 |
| Molecular Formula | C21H25N2O5P |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(2-diethoxyphosphorylethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CCOP(=O)(CCNC(=O)c1cccc2c(=O)c3cccc(C)c3[nH]c12)OCC |
| InChI | InChI=1S/C21H25N2O5P/c1-4-27-29(26,28-5-2)13-12-22-21(25)17-11-7-10-16-19(17)23-18-14(3)8-6-9-15(18)20(16)24/h6-11H,4-5,12-13H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | VRYOHFIELOPHRC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|