C30H29N5O3 — CID 118730891
1-[bis(pyridin-2-ylmethyl)amino]-N-(2-methoxyethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide (PubChem CID 118730891) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is 1-[bis(pyridin-2-ylmethyl)amino]-N-(2-methoxyethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | 1-[bis(pyridin-2-ylmethyl)amino]-N-(2-methoxyethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 118730891 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[bis(pyridin-2-ylmethyl)amino]-N-(2-methoxyethyl)-5-methyl-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COCCNC(=O)c1ccc(N(Cc2ccccn2)Cc2ccccn2)c2c(=O)c3cccc(C)c3[nH]c12 |
| InChI | InChI=1S/C30H29N5O3/c1-20-8-7-11-23-27(20)34-28-24(30(37)33-16-17-38-2)12-13-25(26(28)29(23)36)35(18-21-9-3-5-14-31-21)19-22-10-4-6-15-32-22/h3-15H,16-19H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | CUTSHUYZNAVAGO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|