C22H23ClN2O5 — CID 175384871
methyl 6-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]hexanoate (PubChem CID 175384871) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is methyl 6-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 175384871 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl 6-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(Cl)c2c(=O)c3cccc(OC)c3[nH]c12 |
| InChI | InChI=1S/C22H23ClN2O5/c1-29-16-8-6-7-13-19(16)25-20-14(10-11-15(23)18(20)21(13)27)22(28)24-12-5-3-4-9-17(26)30-2/h6-8,10-11H,3-5,9,12H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QZIXMWXPGXJPPF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|