About 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate
1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate (PubChem CID 175605047) has the molecular formula C22H25ClN2O5
and a molecular weight of 432.90 g/mol. Its IUPAC name is 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate.
Molecular Properties
| Compound Name | 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate |
| PubChem CID | 175605047 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate |
| SMILES | CCCCCC(=O)OC.COc1cccc2c(=O)c3c(Cl)ccc(C(N)=O)c3[nH]c12 |
| InChI | InChI=1S/C15H11ClN2O3.C7H14O2/c1-21-10-4-2-3-7-12(10)18-13-8(15(17)20)5-6-9(16)11(13)14(7)19;1-3-4-5-6-7(8)9-2/h2-6H,1H3,(H2,17,20)(H,18,19);3-6H2,1-2H3 |
| InChIKey | WTAMOHOMLCCOBF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate?
The IUPAC name of 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate (CID 175605047) is 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate.
What is the SMILES notation for 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate?
The canonical SMILES for 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate is CCCCCC(=O)OC.COc1cccc2c(=O)c3c(Cl)ccc(C(N)=O)c3[nH]c12.
What is the InChIKey of 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate?
The InChIKey is WTAMOHOMLCCOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2O3.C7H14O2/c1-21-10-4-2-3-7-12(10)18-13-8(15(17)20)5-6-9(16)11(13)14(7)19;1-3-4-5-6-7(8)9-2/h2-6H,1H3,(H2,17,20)(H,18,19);3-6H2,1-2H3.
What are the key properties of 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate?
1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate has a molecular weight of 432.90 g/mol, XLogP of 4.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-methoxy-9-oxo-10H-acridine-4-carboxamide;methyl hexanoate is sourced from PubChem (CID 175605047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).