C22H23ClN2O5 — CID 175384877
7-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]heptanoic acid (PubChem CID 175384877) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is 7-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 175384877 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 7-[(1-chloro-5-methoxy-9-oxo-10H-acridine-4-carbonyl)amino]heptanoic acid |
| SMILES | COc1cccc2c(=O)c3c(Cl)ccc(C(=O)NCCCCCCC(=O)O)c3[nH]c12 |
| InChI | InChI=1S/C22H23ClN2O5/c1-30-16-8-6-7-13-19(16)25-20-14(10-11-15(23)18(20)21(13)28)22(29)24-12-5-3-2-4-9-17(26)27/h6-8,10-11H,2-5,9,12H2,1H3,(H,24,29)(H,25,28)(H,26,27) |
| InChIKey | LGUHLDBOLKCEQJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|