C15H15ClN2O3 — CID 106766075
methyl 4-[(1-chloroisoquinoline-4-carbonyl)amino]butanoate (PubChem CID 106766075) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is methyl 4-[(1-chloroisoquinoline-4-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(1-chloroisoquinoline-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 106766075 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | methyl 4-[(1-chloroisoquinoline-4-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H15ClN2O3/c1-21-13(19)7-4-8-17-15(20)12-9-18-14(16)11-6-3-2-5-10(11)12/h2-3,5-6,9H,4,7-8H2,1H3,(H,17,20) |
| InChIKey | YVPLLALURDERCU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|