C13H10ClN3O — CID 106766059
1-chloro-N-(2-cyanoethyl)isoquinoline-4-carboxamide (PubChem CID 106766059) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 1-chloro-N-(2-cyanoethyl)isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-(2-cyanoethyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106766059 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-chloro-N-(2-cyanoethyl)isoquinoline-4-carboxamide |
| SMILES | N#CCCNC(=O)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C13H10ClN3O/c14-12-10-5-2-1-4-9(10)11(8-17-12)13(18)16-7-3-6-15/h1-2,4-5,8H,3,7H2,(H,16,18) |
| InChIKey | RAXIOSFVEMSOJJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|