C16H17ClN2O2 — CID 106832077
N-(2-but-3-enoxyethyl)-1-chloroisoquinoline-4-carboxamide (PubChem CID 106832077) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-1-chloroisoquinoline-4-carboxamide.
| Compound Name | N-(2-but-3-enoxyethyl)-1-chloroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106832077 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-1-chloroisoquinoline-4-carboxamide |
| SMILES | C=CCCOCCNC(=O)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C16H17ClN2O2/c1-2-3-9-21-10-8-18-16(20)14-11-19-15(17)13-7-5-4-6-12(13)14/h2,4-7,11H,1,3,8-10H2,(H,18,20) |
| InChIKey | UAPPGHHIQFGKPB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|