C47H40N6O2+2 — CID 132991441
3-methyl-2-[[3-methyl-7-[(1-methylquinolin-1-ium-3-yl)carbamoyl]-1H-indol-2-yl]-phenylmethyl]-N-(1-methylquinolin-1-ium-3-yl)-1H-indole-7-carboxamide (PubChem CID 132991441) has the molecular formula C47H40N6O2+2 and a molecular weight of 720.88 g/mol. Its IUPAC name is 3-methyl-2-[[3-methyl-7-[(1-methylquinolin-1-ium-3-yl)carbamoyl]-1H-indol-2-yl]-phenylmethyl]-N-(1-methylquinolin-1-ium-3-yl)-1H-indole-7-carboxamide.
| Compound Name | 3-methyl-2-[[3-methyl-7-[(1-methylquinolin-1-ium-3-yl)carbamoyl]-1H-indol-2-yl]-phenylmethyl]-N-(1-methylquinolin-1-ium-3-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 132991441 |
| Molecular Formula | C47H40N6O2+2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | 3-methyl-2-[[3-methyl-7-[(1-methylquinolin-1-ium-3-yl)carbamoyl]-1H-indol-2-yl]-phenylmethyl]-N-(1-methylquinolin-1-ium-3-yl)-1H-indole-7-carboxamide |
| SMILES | Cc1c(C(c2ccccc2)c2[nH]c3c(C(=O)Nc4cc5ccccc5[n+](C)c4)cccc3c2C)[nH]c2c(C(=O)Nc3cc4ccccc4[n+](C)c3)cccc12 |
| InChI | InChI=1S/C47H38N6O2/c1-28-35-18-12-20-37(46(54)48-33-24-31-16-8-10-22-39(31)52(3)26-33)44(35)50-42(28)41(30-14-6-5-7-15-30)43-29(2)36-19-13-21-38(45(36)51-43)47(55)49-34-25-32-17-9-11-23-40(32)53(4)27-34/h5-27,41H,1-4H3,(H2-2,48,49,50,51,54,55)/p+2 |
| InChIKey | JAVRXLZUVRHKPY-UHFFFAOYSA-P |
| XLogP | 8.91 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|