C22H23N3O3 — CID 35389393
N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 35389393) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 35389393 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc3c(C)c(C)[nH]c23)cc1N1CCCC1=O |
| InChI | InChI=1S/C22H23N3O3/c1-13-14(2)23-21-16(13)6-4-7-17(21)22(27)24-15-9-10-19(28-3)18(12-15)25-11-5-8-20(25)26/h4,6-7,9-10,12,23H,5,8,11H2,1-3H3,(H,24,27) |
| InChIKey | JAFAZDUOPPKLHH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|