C20H22N2O3 — CID 7687400
2-methoxy-N-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]benzamide (PubChem CID 7687400) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-methoxy-N-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]benzamide.
| Compound Name | 2-methoxy-N-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7687400 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-methoxy-N-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N2CCCCC2=O)c(C)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-14-13-15(10-11-17(14)22-12-6-5-9-19(22)23)21-20(24)16-7-3-4-8-18(16)25-2/h3-4,7-8,10-11,13H,5-6,9,12H2,1-2H3,(H,21,24) |
| InChIKey | UNPIXFOLJGZBQC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |