C21H22N2O4 — CID 7687744
[2-[[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl]phenyl] acetate (PubChem CID 7687744) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-[[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 7687744 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [2-[[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ccc(C)c(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-14-10-11-16(13-18(14)23-12-6-5-9-20(23)25)22-21(26)17-7-3-4-8-19(17)27-15(2)24/h3-4,7-8,10-11,13H,5-6,9,12H2,1-2H3,(H,22,26) |
| InChIKey | URDKBJCGHCCTCY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|