C18H12BrF2NO — CID 146022041
N-(5-bromonaphthalen-2-yl)-2-(3,4-difluorophenyl)acetamide (PubChem CID 146022041) has the molecular formula C18H12BrF2NO and a molecular weight of 376.20 g/mol. Its IUPAC name is N-(5-bromonaphthalen-2-yl)-2-(3,4-difluorophenyl)acetamide.
| Compound Name | N-(5-bromonaphthalen-2-yl)-2-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 146022041 |
| Molecular Formula | C18H12BrF2NO |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N-(5-bromonaphthalen-2-yl)-2-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)Nc1ccc2c(Br)cccc2c1 |
| InChI | InChI=1S/C18H12BrF2NO/c19-15-3-1-2-12-10-13(5-6-14(12)15)22-18(23)9-11-4-7-16(20)17(21)8-11/h1-8,10H,9H2,(H,22,23) |
| InChIKey | BKAYHVOTDPUGOC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |