C19H16Cl2N2O2 — CID 91115284
1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(3,4-dimethylphenyl)urea (PubChem CID 91115284) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 91115284 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(Cl)cc(Cl)c3ccc(O)cc23)cc1C |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-10-3-4-12(7-11(10)2)22-19(25)23-18-15-8-13(24)5-6-14(15)16(20)9-17(18)21/h3-9,24H,1-2H3,(H2,22,23,25) |
| InChIKey | HRCBCIWSABVLNQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |