C17H9Cl2F3N2O2 — CID 90987709
1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(2,4,5-trifluorophenyl)urea (PubChem CID 90987709) has the molecular formula C17H9Cl2F3N2O2 and a molecular weight of 401.17 g/mol. Its IUPAC name is 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 90987709 |
| Molecular Formula | C17H9Cl2F3N2O2 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)c(F)cc1F)Nc1c(Cl)cc(Cl)c2ccc(O)cc12 |
| InChI | InChI=1S/C17H9Cl2F3N2O2/c18-10-4-11(19)16(9-3-7(25)1-2-8(9)10)24-17(26)23-15-6-13(21)12(20)5-14(15)22/h1-6,25H,(H2,23,24,26) |
| InChIKey | OKFWDEXGCLXJQJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|