C8H8ClFN2O2 — CID 126554696
1-(4-chloro-2-fluoro-5-hydroxyphenyl)-3-methylurea (PubChem CID 126554696) has the molecular formula C8H8ClFN2O2 and a molecular weight of 218.61 g/mol. Its IUPAC name is 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-3-methylurea.
| Compound Name | 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-3-methylurea |
|---|---|
| PubChem CID | 126554696 |
| Molecular Formula | C8H8ClFN2O2 |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(O)c(Cl)cc1F |
| InChI | InChI=1S/C8H8ClFN2O2/c1-11-8(14)12-6-3-7(13)4(9)2-5(6)10/h2-3,13H,1H3,(H2,11,12,14) |
| InChIKey | XGYBVYCBDJEFOD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |