C14H11Cl2FN2O2 — CID 13102554
1-(3,5-dichloro-4-fluoro-2-phenoxyphenyl)-3-methylurea (PubChem CID 13102554) has the molecular formula C14H11Cl2FN2O2 and a molecular weight of 329.16 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluoro-2-phenoxyphenyl)-3-methylurea.
| Compound Name | 1-(3,5-dichloro-4-fluoro-2-phenoxyphenyl)-3-methylurea |
|---|---|
| PubChem CID | 13102554 |
| Molecular Formula | C14H11Cl2FN2O2 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-(3,5-dichloro-4-fluoro-2-phenoxyphenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(Cl)c(F)c(Cl)c1Oc1ccccc1 |
| InChI | InChI=1S/C14H11Cl2FN2O2/c1-18-14(20)19-10-7-9(15)12(17)11(16)13(10)21-8-5-3-2-4-6-8/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | SYCWLKFXUWCGJL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|