C25H16Cl3FN2O3 — CID 91267078
[5,7-dichloro-8-[[3-(4-chloro-3-fluorophenyl)phenyl]carbamoylamino]naphthalen-2-yl] acetate (PubChem CID 91267078) has the molecular formula C25H16Cl3FN2O3 and a molecular weight of 517.77 g/mol. Its IUPAC name is [5,7-dichloro-8-[[3-(4-chloro-3-fluorophenyl)phenyl]carbamoylamino]naphthalen-2-yl] acetate.
| Compound Name | [5,7-dichloro-8-[[3-(4-chloro-3-fluorophenyl)phenyl]carbamoylamino]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 91267078 |
| Molecular Formula | C25H16Cl3FN2O3 |
| Molecular Weight | 517.77 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | [5,7-dichloro-8-[[3-(4-chloro-3-fluorophenyl)phenyl]carbamoylamino]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(Cl)cc(Cl)c(NC(=O)Nc3cccc(-c4ccc(Cl)c(F)c4)c3)c2c1 |
| InChI | InChI=1S/C25H16Cl3FN2O3/c1-13(32)34-17-6-7-18-19(11-17)24(22(28)12-21(18)27)31-25(33)30-16-4-2-3-14(9-16)15-5-8-20(26)23(29)10-15/h2-12H,1H3,(H2,30,31,33) |
| InChIKey | CXSSBAXNVYJHGW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.77 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|