C18H14Cl2N2O3 — CID 91210833
1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(4-methoxyphenyl)urea (PubChem CID 91210833) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 91210833 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-(2,4-dichloro-7-hydroxynaphthalen-1-yl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2c(Cl)cc(Cl)c3ccc(O)cc23)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-25-12-5-2-10(3-6-12)21-18(24)22-17-14-8-11(23)4-7-13(14)15(19)9-16(17)20/h2-9,23H,1H3,(H2,21,22,24) |
| InChIKey | RTQLWKRAUPPUNI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |