C19H28O4 — CID 138733994
bis(2-methylpropyl) 3-propylbenzene-1,2-dicarboxylate (PubChem CID 138733994) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is bis(2-methylpropyl) 3-propylbenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 3-propylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138733994 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | bis(2-methylpropyl) 3-propylbenzene-1,2-dicarboxylate |
| SMILES | CCCc1cccc(C(=O)OCC(C)C)c1C(=O)OCC(C)C |
| InChI | InChI=1S/C19H28O4/c1-6-8-15-9-7-10-16(18(20)22-11-13(2)3)17(15)19(21)23-12-14(4)5/h7,9-10,13-14H,6,8,11-12H2,1-5H3 |
| InChIKey | NDVUCEAUCXMYFM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |