C13H17Cl3N3O3+ — CID 7430465
tert-butyl-[(1R)-2,2,2-trichloro-1-[(3-nitrobenzoyl)amino]ethyl]azanium (PubChem CID 7430465) has the molecular formula C13H17Cl3N3O3+ and a molecular weight of 369.66 g/mol. Its IUPAC name is tert-butyl-[(1R)-2,2,2-trichloro-1-[(3-nitrobenzoyl)amino]ethyl]azanium.
| Compound Name | tert-butyl-[(1R)-2,2,2-trichloro-1-[(3-nitrobenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7430465 |
| Molecular Formula | C13H17Cl3N3O3+ |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | tert-butyl-[(1R)-2,2,2-trichloro-1-[(3-nitrobenzoyl)amino]ethyl]azanium |
| SMILES | CC(C)(C)[NH2+][C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3N3O3/c1-12(2,3)18-11(13(14,15)16)17-10(20)8-5-4-6-9(7-8)19(21)22/h4-7,11,18H,1-3H3,(H,17,20)/p+1/t11-/m1/s1 |
| InChIKey | ZOTUCVGZJLMMQI-LLVKDONJSA-O |
| XLogP | 2.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|