C19H28Cl3N2O+ — CID 2247149
N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-4-tert-butylbenzamide (PubChem CID 2247149) has the molecular formula C19H28Cl3N2O+ and a molecular weight of 406.81 g/mol. Its IUPAC name is N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-4-tert-butylbenzamide.
| Compound Name | N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 2247149 |
| Molecular Formula | C19H28Cl3N2O+ |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N[C@H]([NH+]2CCCCCC2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H27Cl3N2O/c1-18(2,3)15-10-8-14(9-11-15)16(25)23-17(19(20,21)22)24-12-6-4-5-7-13-24/h8-11,17H,4-7,12-13H2,1-3H3,(H,23,25)/p+1/t17-/m1/s1 |
| InChIKey | VVCFQNPIHDNFSB-QGZVFWFLSA-O |
| XLogP | 3.87 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|