C13H15BrCl3N2O+ — CID 5103173
4-bromo-N-(2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl)benzamide (PubChem CID 5103173) has the molecular formula C13H15BrCl3N2O+ and a molecular weight of 401.54 g/mol. Its IUPAC name is 4-bromo-N-(2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl)benzamide.
| Compound Name | 4-bromo-N-(2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 5103173 |
| Molecular Formula | C13H15BrCl3N2O+ |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | 4-bromo-N-(2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl)benzamide |
| SMILES | O=C(NC([NH+]1CCCC1)C(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrCl3N2O/c14-10-5-3-9(4-6-10)11(20)18-12(13(15,16)17)19-7-1-2-8-19/h3-6,12H,1-2,7-8H2,(H,18,20)/p+1 |
| InChIKey | KGFUYJNBINRBOJ-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|