C21H24Cl5N3O2 — CID 5142122
3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 5142122) has the molecular formula C21H24Cl5N3O2 and a molecular weight of 527.71 g/mol. Its IUPAC name is 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 5142122 |
| Molecular Formula | C21H24Cl5N3O2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)NC(N1CC2CC(C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H24Cl5N3O2/c1-20(2)13(7-15(22)23)17(20)18(31)27-19(21(24,25)26)28-8-11-6-12(10-28)14-4-3-5-16(30)29(14)9-11/h3-5,7,11-13,17,19H,6,8-10H2,1-2H3,(H,27,31) |
| InChIKey | KUHHFYZRWGDWMX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|