C16H18N2O4S — CID 90496673
N'-(2-ethoxyphenyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxamide (PubChem CID 90496673) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N'-(2-ethoxyphenyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N'-(2-ethoxyphenyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 90496673 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N'-(2-ethoxyphenyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-2-22-14-6-4-3-5-12(14)18-16(21)15(20)17-9-13(19)11-7-8-23-10-11/h3-8,10,13,19H,2,9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | PTWCBVQRQVBRAM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|