C17H23NOS — CID 103785265
1-thiophen-3-yl-2-[1-(2,4,6-trimethylphenyl)ethylamino]ethanol (PubChem CID 103785265) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-thiophen-3-yl-2-[1-(2,4,6-trimethylphenyl)ethylamino]ethanol.
| Compound Name | 1-thiophen-3-yl-2-[1-(2,4,6-trimethylphenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 103785265 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-thiophen-3-yl-2-[1-(2,4,6-trimethylphenyl)ethylamino]ethanol |
| SMILES | Cc1cc(C)c(C(C)NCC(O)c2ccsc2)c(C)c1 |
| InChI | InChI=1S/C17H23NOS/c1-11-7-12(2)17(13(3)8-11)14(4)18-9-16(19)15-5-6-20-10-15/h5-8,10,14,16,18-19H,9H2,1-4H3 |
| InChIKey | QBQKOZBWTZUAMF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |