C12H20N2O2S — CID 114188533
N-butan-2-yl-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]acetamide (PubChem CID 114188533) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]acetamide.
| Compound Name | N-butan-2-yl-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 114188533 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-butan-2-yl-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]acetamide |
| SMILES | CCC(C)NC(=O)CNCC(O)c1ccsc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-3-9(2)14-12(16)7-13-6-11(15)10-4-5-17-8-10/h4-5,8-9,11,13,15H,3,6-7H2,1-2H3,(H,14,16) |
| InChIKey | PEXMLVZUENYPOR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |