C14H13FN2OS — CID 106434833
2-fluoro-5-[[(2-hydroxy-2-thiophen-3-ylethyl)amino]methyl]benzonitrile (PubChem CID 106434833) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-fluoro-5-[[(2-hydroxy-2-thiophen-3-ylethyl)amino]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[(2-hydroxy-2-thiophen-3-ylethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 106434833 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-fluoro-5-[[(2-hydroxy-2-thiophen-3-ylethyl)amino]methyl]benzonitrile |
| SMILES | N#Cc1cc(CNCC(O)c2ccsc2)ccc1F |
| InChI | InChI=1S/C14H13FN2OS/c15-13-2-1-10(5-12(13)6-16)7-17-8-14(18)11-3-4-19-9-11/h1-5,9,14,17-18H,7-8H2 |
| InChIKey | IITXLFRMCYPPHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |