C15H21F3N2O2 — CID 110930765
1-pyrrolidin-1-yl-3-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 110930765) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-3-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | 1-pyrrolidin-1-yl-3-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 110930765 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-pyrrolidin-1-yl-3-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | OC(CNCc1cccc(OC(F)(F)F)c1)CN1CCCC1 |
| InChI | InChI=1S/C15H21F3N2O2/c16-15(17,18)22-14-5-3-4-12(8-14)9-19-10-13(21)11-20-6-1-2-7-20/h3-5,8,13,19,21H,1-2,6-7,9-11H2 |
| InChIKey | GERGJZQUDPLAJE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |