C11H14N2O3S2 — CID 106731636
3-(2-propan-2-ylsulfonylethyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 106731636) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(2-propan-2-ylsulfonylethyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(2-propan-2-ylsulfonylethyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 106731636 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-(2-propan-2-ylsulfonylethyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | CC(C)S(=O)(=O)CCn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C11H14N2O3S2/c1-8(2)18(15,16)6-4-13-7-12-9-3-5-17-10(9)11(13)14/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | LKUBVZIPCHEHIU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |