About 3-nonylthieno[3,2-d]pyrimidin-4-one
3-nonylthieno[3,2-d]pyrimidin-4-one (PubChem CID 115582352) has the molecular formula C15H22N2OS
and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-nonylthieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-nonylthieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 115582352 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-nonylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C15H22N2OS/c1-2-3-4-5-6-7-8-10-17-12-16-13-9-11-19-14(13)15(17)18/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | RJRLENAQDPVRCH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonylthieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonylthieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-nonylthieno[3,2-d]pyrimidin-4-one (CID 115582352) is 3-nonylthieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-nonylthieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-nonylthieno[3,2-d]pyrimidin-4-one is CCCCCCCCCn1cnc2ccsc2c1=O.
What is the InChIKey of 3-nonylthieno[3,2-d]pyrimidin-4-one?
The InChIKey is RJRLENAQDPVRCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2OS/c1-2-3-4-5-6-7-8-10-17-12-16-13-9-11-19-14(13)15(17)18/h9,11-12H,2-8,10H2,1H3.
What are the key properties of 3-nonylthieno[3,2-d]pyrimidin-4-one?
3-nonylthieno[3,2-d]pyrimidin-4-one has a molecular weight of 278.42 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonylthieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 115582352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).