C15H22N2OS — CID 115582352
3-nonylthieno[3,2-d]pyrimidin-4-one (PubChem CID 115582352) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-nonylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-nonylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 115582352 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-nonylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C15H22N2OS/c1-2-3-4-5-6-7-8-10-17-12-16-13-9-11-19-14(13)15(17)18/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | RJRLENAQDPVRCH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|