C13H17N3OS — CID 116620730
3-(3-pyrrolidin-1-ylpropyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 116620730) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-(3-pyrrolidin-1-ylpropyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(3-pyrrolidin-1-ylpropyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 116620730 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-(3-pyrrolidin-1-ylpropyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1CCCN1CCCC1 |
| InChI | InChI=1S/C13H17N3OS/c17-13-12-11(4-9-18-12)14-10-16(13)8-3-7-15-5-1-2-6-15/h4,9-10H,1-3,5-8H2 |
| InChIKey | XWJJGCDWNWAVPC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |