C12H16N2OS — CID 116620736
3-(4-methylpentyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 116620736) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-(4-methylpentyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(4-methylpentyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 116620736 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(4-methylpentyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | CC(C)CCCn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C12H16N2OS/c1-9(2)4-3-6-14-8-13-10-5-7-16-11(10)12(14)15/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | HDAQUTRXGGUJRA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |